Drugs Information: Dextroamphetamine
Basic Information
|
||
| ID | DDInter526 | |
| Drug Type | small molecule | |
| Molecular Formula | C9H13N | |
| Molecular Weight | 135.210 | |
| Description | Dextroamphetamine is a sympathomimetic agent used in the treatment of attention deficit hyperactivity disorder (ADHD) and narcolepsy. | |
| ATC Classification | N06BA02 | |
| IUPAC Name | (2S)-1-Phenylpropan-2-Amine | |
| InChI | Inchi=1S/C9H13N/C1-8(10)7-9-5-3-2-4-6-9/H2-6,8H,7,10H2,1H3/T8-/M0/S1 | |
| InChI Key | KWTSXDURSIMDCE-QMMMGPOBSA-N | |
| Canonical SMILES | C[C@H](N)CC1=CC=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Dextroamphetamine
| Severity level | ID | Name | Mechanism | Detail |
|---|