Drugs Information: Difluprednate (ophthalmic)
Basic Information
|
||
| ID | DDInter552 | |
| Drug Type | small molecule | |
| Molecular Formula | C27H34F2O7 | |
| Molecular Weight | 508.558 | |
| Description | Difluprednate is a topical corticosteroid used for the symptomatic treatment of inflammation and pain associated with ocular surgery. | |
| ATC Classification | D07AC19 | |
| IUPAC Name | (1R,2S,8S,10S,11S,14R,15S,17S)-14-[2-(Acetyloxy)Acetyl]-1,8-Difluoro-17-Hydroxy-2,15-Dimethyl-5-Oxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵] | |
| InChI | Inchi=1S/C27H34F2O7/C1-5-6-23(34)36-26(22(33)14-35-15(2)30)10-8-17-18-12-20(28)19-11-16(31)7-9-24(19,3)27(18,29)21(32)13-25(17,26)4/H7,9,11,17-18,20-21,32H,5-6,8,10,12-14H2,1-4H3/T17-,18-,20-,21-,24-,25-,26-,27-/M0/S1 | |
| InChI Key | WYQPLTPSGFELIB-JTQPXKBDSA-N | |
| Canonical SMILES | [H][C@@]12CC[C@](OC(=O)CCC)(C(=O)COC(C)=O)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])C[C@H](F)C2=CC(=O)C=C[C@]12C | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Difluprednate (ophthalmic)
| Severity level | ID | Name | Mechanism | Detail |
|---|