Drugs Information: Digoxin
Basic Information
|
||
| ID | DDInter554 | |
| Drug Type | small molecule | |
| Molecular Formula | C41H64O14 | |
| Molecular Weight | 780.949 | |
| Description | Digoxin is a cardiac glycoside used in the treatment of mild to moderate heart failure and for ventricular response rate control in chronic atrial fibrillation. | |
| ATC Classification | C01AA05 | |
| IUPAC Name | 4-[(1S,2S,5S,7R,10R,11S,14R,15S,16R)-5-{[(2R,4S,5S,6R)-5-{[(2S,4S,5S,6R)-5-{[(2S,4S,5S,6R)-4,5-Dihydroxy-6-Methyloxan-2-Yl]Oxy}- | |
| InChI | Inchi=1S/C41H64O14/C1-19-36(47)28(42)15-34(50-19)54-38-21(3)52-35(17-30(38)44)55-37-20(2)51-33(16-29(37)43)53-24-8-10-39(4)23(13-24)6-7-26-27(39)14-31(45)40(5)25(9-11-41(26,40)48)22-12-32(46)49-18-22/H12,19-21,23-31,33-38,42-45,47-48H,6-11,13-18H2,1-5H3/T19-,20-,21-,23-,24+,25-,26-,27+,28+,29+,30+,31-,33+,34+,35+,36-,37-,38-,39+,40+,41+/M1/S1 | |
| InChI Key | LTMHDMANZUZIPE-PUGKRICDSA-N | |
| Canonical SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(C[C@@H](O)[C@]4(C)[C@H](CC[C@]34O)C3=CC(=O)OC3)[C@@]1(C)CC[C@@H](C2)O[C@H]1C[C@H](O)[C@H](O[C@H]2C[C@H](O)[C@H](O[C@H]3C[C@H](O)[C@H](O)[C@@H](C)O3)[C@@H](C)O2)[C@@H](C)O1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Digoxin
| Severity level | ID | Name | Mechanism | Detail |
|---|