Drugs Information: Diiodohydroxyquinoline
Basic Information
|
||
| ID | DDInter559 | |
| Drug Type | small molecule | |
| Molecular Formula | C9H5I2No | |
| Molecular Weight | 396.953 | |
| Description | Diiodohydroxyquinoline, also known as uidoquinol and iodoquinol, is a quinoline derivative that can be used in the treatment of amoebiasis. The exact mechanism of action is unknown. Iodoquinol is not currently available in any FDA-approved products. | |
| ATC Classification | G01AC01 | |
| IUPAC Name | 5,7-Diiodoquinolin-8-Ol | |
| InChI | Inchi=1S/C9H5I2No/C10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/H1-4,13H | |
| InChI Key | UXZFQZANDVDGMM-UHFFFAOYSA-N | |
| Canonical SMILES | OC1=C2N=CC=CC2=C(I)C=C1I | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Diiodohydroxyquinoline
| Severity level | ID | Name | Mechanism | Detail |
|---|