Drugs Information: Dimethyl fumarate
Basic Information
|
||
| ID | DDInter564 | |
| Drug Type | small molecule | |
| Molecular Formula | C6H8O4 | |
| Molecular Weight | 144.126 | |
| Description | Dimethyl fumarate is a medication used to treat patients with the relapsing-remitting form of multiple sclerosis. | |
| ATC Classification | L04AX07 | |
| IUPAC Name | 1,4-Dimethyl (2E)-But-2-Enedioate | |
| InChI | Inchi=1S/C6H8O4/C1-9-5(7)3-4-6(8)10-2/H3-4H,1-2H3/B4-3+ | |
| InChI Key | LDCRTTXIJACKKU-ONEGZZNKSA-N | |
| Canonical SMILES | [H]\C(=C(\[H])C(=O)OC)C(=O)OC | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Dimethyl fumarate
| Severity level | ID | Name | Mechanism | Detail |
|---|