Drugs Information: Dimethyl sulfoxide
Basic Information
|
||
| ID | DDInter565 | |
| Drug Type | small molecule | |
| Molecular Formula | C2H6Os | |
| Molecular Weight | 78.135 | |
| Description | Dimethyl sulfoxide is a reversible mitogen-activated extracellular signal-regulated kinase-1 (MEK1) and MEK2 inhibitor used to treat certain types of melanoma, metastatic non-small cell lung cancer, and locally advanced or metastatic anaplastic thyroid cancer. | |
| ATC Classification | M02AX03 G04BX13 | |
| IUPAC Name | Methanesulfinylmethane | |
| InChI | Inchi=1S/C2H6Os/C1-4(2)3/H1-2H3 | |
| InChI Key | IAZDPXIOMUYVGZ-UHFFFAOYSA-N | |
| Canonical SMILES | CS(C)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Dimethyl sulfoxide
| Severity level | ID | Name | Mechanism | Detail |
|---|