Drugs Information: Dinoprostone
Basic Information
|
||
| ID | DDInter566 | |
| Drug Type | small molecule | |
| Molecular Formula | C20H32O5 | |
| Molecular Weight | 352.471 | |
| Description | Dinoprostone is a prostaglandin used to induce labor or abortion as well as to treat nonmetastatic gestational trophoblastic disease. | |
| ATC Classification | G02AD02 | |
| IUPAC Name | (5Z)-7-[(1R,2R,3R)-3-Hydroxy-2-[(1E,3S)-3-Hydroxyoct-1-En-1-Yl]-5-Oxocyclopentyl]Hept-5-Enoic Acid | |
| InChI | Inchi=1S/C20H32O5/C1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/H4,7,12-13,15-17,19,21,23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/B7-4-,13-12+/T15-,16+,17+,19+/M0/S1 | |
| InChI Key | XEYBRNLFEZDVAW-ARSRFYASSA-N | |
| Canonical SMILES | CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Dinoprostone
| Severity level | ID | Name | Mechanism | Detail |
|---|