Drugs Information: Altretamine
Basic Information
|
||
| ID | DDInter57 | |
| Drug Type | small molecule | |
| Molecular Formula | C9H18N6 | |
| Molecular Weight | 210.285 | |
| Description | Altretamine is an antineoplastic agent used in palliative treatment of persistent or recurrent ovarian cancer. | |
| ATC Classification | L01XX03 | |
| IUPAC Name | N2,N2,N4,N4,N6,N6-Hexamethyl-1,3,5-Triazine-2,4,6-Triamine | |
| InChI | Inchi=1S/C9H18N6/C1-13(2)7-10-8(14(3)4)12-9(11-7)15(5)6/H1-6H3 | |
| InChI Key | UUVWYPNAQBNQJQ-UHFFFAOYSA-N | |
| Canonical SMILES | CN(C)C1=NC(=NC(=N1)N(C)C)N(C)C | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Altretamine
| Severity level | ID | Name | Mechanism | Detail |
|---|