Drugs Information: Doripenem
Basic Information
|
||
| ID | DDInter586 | |
| Drug Type | small molecule | |
| Molecular Formula | C15H24N4O6S2 | |
| Molecular Weight | 420.511 | |
| Description | Doripenem is an antibiotic of the penem class used to treat complicated intra-abdominal and urinary tract infections. | |
| ATC Classification | J01DH04 | |
| IUPAC Name | (4R,5S,6S)-6-[(1R)-1-Hydroxyethyl]-4-Methyl-7-Oxo-3-{[(3S,5S)-5-[(Sulfamoylamino)Methyl]Pyrrolidin-3-Yl]Sulfanyl}-1-Azabicyclo[3 | |
| InChI | Inchi=1S/C15H24N4O6S2/C1-6-11-10(7(2)20)14(21)19(11)12(15(22)23)13(6)26-9-3-8(17-5-9)4-18-27(16,24)25/H6-11,17-18,20H,3-5H2,1-2H3,(H,22,23)(H2,16,24,25)/T6-,7-,8+,9+,10-,11-/M1/S1 | |
| InChI Key | AVAACINZEOAHHE-VFZPANTDSA-N | |
| Canonical SMILES | [H][C@]12[C@@H](C)C(S[C@@H]3CN[C@H](CNS(N)(=O)=O)C3)=C(N1C(=O)[C@]2([H])[C@@H](C)O)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Doripenem
| Severity level | ID | Name | Mechanism | Detail |
|---|