Drugs Information: Alvimopan
Basic Information
|
|
||
| ID | DDInter59 | |
| Drug Type | small molecule | |
| Molecular Formula | C25H32N2O4 | |
| Molecular Weight | 424.541 | |
| Description | Alvimopan is an opioid antagonist used to reduce healing time of the upper and lower gastrointestinal tract following surgical procedures that involve bowel resection with primary anastomosis. | |
| ATC Classification | A06AH02 | |
| IUPAC Name | 2-[(2S)-2-Benzyl-3-[(3R,4R)-4-(3-Hydroxyphenyl)-3,4-Dimethylpiperidin-1-Yl]Propanamido]Acetic Acid | |
| InChI | Inchi=1S/C25H32N2O4/C1-18-16-27(12-11-25(18,2)21-9-6-10-22(28)14-21)17-20(24(31)26-15-23(29)30)13-19-7-4-3-5-8-19/H3-10,14,18,20,28H,11-13,15-17H2,1-2H3,(H,26,31)(H,29,30)/T18-,20-,25+/M0/S1 | |
| InChI Key | UPNUIXSCZBYVBB-JVFUWBCBSA-N | |
| Canonical SMILES | C[C@H]1CN(C[C@H](CC2=CC=CC=C2)C(=O)NCC(O)=O)CC[C@@]1(C)C1=CC(O)=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Alvimopan
| Severity level | ID | Name | Mechanism | Detail |
|---|