Drugs Information: Doxercalciferol
Basic Information
|
||
| ID | DDInter595 | |
| Drug Type | small molecule | |
| Molecular Formula | C28H44O2 | |
| Molecular Weight | 412.658 | |
| Description | Doxercalciferol is a synthetic vitamin D2 analog used to treat secondary hyperparathyroidism in patients with chronic kidney disease with or without therapy of dialysis. | |
| ATC Classification | H05BX03 | |
| IUPAC Name | (1R,3S,5Z)-5-{2-[(1R,3As,4E,7Ar)-1-[(2R,3E,5R)-5,6-Dimethylhept-3-En-2-Yl]-7A-Methyl-Octahydro-1H-Inden-4-Ylidene]Ethylidene}-4- | |
| InChI | Inchi=1S/C28H44O2/C1-18(2)19(3)9-10-20(4)25-13-14-26-22(8-7-15-28(25,26)6)11-12-23-16-24(29)17-27(30)21(23)5/H9-12,18-20,24-27,29-30H,5,7-8,13-17H2,1-4,6H3/B10-9+,22-11+,23-12-/T19-,20+,24+,25+,26-,27-,28+/M0/S1 | |
| InChI Key | HKXBNHCUPKIYDM-CGMHZMFXSA-N | |
| Canonical SMILES | [H][C@@]1(CC[C@@]2([H])\C(CCC[C@]12C)=C\C=C1\C[C@@H](O)C[C@H](O)C1=C)[C@H](C)\C=C\[C@H](C)C(C)C | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Doxercalciferol
| Severity level | ID | Name | Mechanism | Detail |
|---|