Drugs Information: Amantadine
Basic Information
|
||
| ID | DDInter60 | |
| Drug Type | small molecule | |
| Molecular Formula | C10H17N | |
| Molecular Weight | 151.253 | |
| Description | Amantadine is a medication used to treat dyskinesia in Parkinson's patients receiving levodopa, as well as extrapyramidal side effects of medications. | |
| ATC Classification | N04BB01 | |
| IUPAC Name | Adamantan-1-Amine | |
| InChI | Inchi=1S/C10H17N/C11-10-4-7-1-8(5-10)3-9(2-7)6-10/H7-9H,1-6,11H2 | |
| InChI Key | DKNWSYNQZKUICI-UHFFFAOYSA-N | |
| Canonical SMILES | NC12CC3CC(CC(C3)C1)C2 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Amantadine
| Severity level | ID | Name | Mechanism | Detail |
|---|