Drugs Information: Dutasteride
Basic Information
|
||
| ID | DDInter611 | |
| Drug Type | small molecule | |
| Molecular Formula | C27H30F6N2O2 | |
| Molecular Weight | 528.537 | |
| Description | Dutasteride is an antiandrogenic compound that is used for the treatment of symptomatic benign prostatic hyperplasia (BPH) in adult males by inhibiting 5-alpha reductase. | |
| ATC Classification | G04CB02 G04CA52 | |
| IUPAC Name | (1S,2R,7R,10S,11S,14S,15S)-N-[2,5-Bis(Trifluoromethyl)Phenyl]-2,15-Dimethyl-5-Oxo-6-Azatetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]Heptadec-3-E | |
| InChI | Inchi=1S/C27H30F6N2O2/C1-24-11-9-17-15(4-8-21-25(17,2)12-10-22(36)35-21)16(24)6-7-19(24)23(37)34-20-13-14(26(28,29)30)3-5-18(20)27(31,32)33/H3,5,10,12-13,15-17,19,21H,4,6-9,11H2,1-2H3,(H,34,37)(H,35,36)/T15-,16-,17-,19+,21+,24-,25+/M0/S1 | |
| InChI Key | JWJOTENAMICLJG-QWBYCMEYSA-N | |
| Canonical SMILES | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC[C@@]4([H])NC(=O)C=C[C@]4(C)[C@@]3([H])CC[C@]12C)C(=O)NC1=CC(=CC=C1C(F)(F)F)C(F)(F)F | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Dutasteride
| Severity level | ID | Name | Mechanism | Detail |
|---|