Drugs Information: Edoxaban
Basic Information
|
||
| ID | DDInter621 | |
| Drug Type | small molecule | |
| Molecular Formula | C24H30Cln7O4S | |
| Molecular Weight | 548.068 | |
| Description | Edoxaban is a novel oral anticoagulant used for reducing the risk of stroke and systemic embolism (SE) in patients with nonvalvular atrial fibrillation (NVAF). | |
| ATC Classification | B01AF03 | |
| IUPAC Name | N'-(5-Chloropyridin-2-Yl)-N-[(1S,2R,4S)-4-(Dimethylcarbamoyl)-2-{5-Methyl-4H,5H,6H,7H-[1,3]Thiazolo[5,4-C]Pyridine-2-Amido}Cyclo | |
| InChI | Inchi=1S/C24H30Cln7O4S/C1-31(2)24(36)13-4-6-15(27-20(33)21(34)30-19-7-5-14(25)11-26-19)17(10-13)28-22(35)23-29-16-8-9-32(3)12-18(16)37-23/H5,7,11,13,15,17H,4,6,8-10,12H2,1-3H3,(H,27,33)(H,28,35)(H,26,30,34)/T13-,15-,17+/M0/S1 | |
| InChI Key | HGVDHZBSSITLCT-JLJPHGGASA-N | |
| Canonical SMILES | CN(C)C(=O)[C@H]1CC[C@H](NC(=O)C(=O)NC2=NC=C(Cl)C=C2)[C@@H](C1)NC(=O)C1=NC2=C(CN(C)CC2)S1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Edoxaban
| Severity level | ID | Name | Mechanism | Detail |
|---|