Drugs Information: Eluxadoline
Basic Information
|
||
| ID | DDInter632 | |
| Drug Type | small molecule | |
| Molecular Formula | C32H35N5O5 | |
| Molecular Weight | 569.662 | |
| Description | Eluxadoline is a mixed mu-opioid receptor agonist used to treat irritable bowel syndrome with diarrhea. | |
| ATC Classification | A07DA06 | |
| IUPAC Name | 5-{[(2S)-2-Amino-3-(4-Carbamoyl-2,6-Dimethylphenyl)-N-[(1S)-1-(4-Phenyl-1H-Imidazol-2-Yl)Ethyl]Propanamido]Methyl}-2-Methoxybenz | |
| InChI | Inchi=1S/C32H35N5O5/C1-18-12-23(29(34)38)13-19(2)24(18)15-26(33)31(39)37(17-21-10-11-28(42-4)25(14-21)32(40)41)20(3)30-35-16-27(36-30)22-8-6-5-7-9-22/H5-14,16,20,26H,15,17,33H2,1-4H3,(H2,34,38)(H,35,36)(H,40,41)/T20-,26-/M0/S1 | |
| InChI Key | QFNHIDANIVGXPE-FNZWTVRRSA-N | |
| Canonical SMILES | COC1=CC=C(CN([C@@H](C)C2=NC(=CN2)C2=CC=CC=C2)C(=O)[C@@H](N)CC2=C(C)C=C(C=C2C)C(N)=O)C=C1C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Eluxadoline
| Severity level | ID | Name | Mechanism | Detail |
|---|