Drugs Information: Elvitegravir
Basic Information
|
||
| ID | DDInter633 | |
| Drug Type | small molecule | |
| Molecular Formula | C23H23Clfno5 | |
| Molecular Weight | 447.890 | |
| Description | Elvitegravir is an antiretroviral agent used in combination with other antiretrovirals for the treatment of HIV-1 infection in antiretroviral treatment-experienced adults. | |
| ATC Classification | J05AR09 J05AX11 J05AR18 | |
| IUPAC Name | 6-[(3-Chloro-2-Fluorophenyl)Methyl]-1-[(2S)-1-Hydroxy-3-Methylbutan-2-Yl]-7-Methoxy-4-Oxo-1,4-Dihydroquinoline-3-Carboxylic Acid | |
| InChI | Inchi=1S/C23H23Clfno5/C1-12(2)19(11-27)26-10-16(23(29)30)22(28)15-8-14(20(31-3)9-18(15)26)7-13-5-4-6-17(24)21(13)25/H4-6,8-10,12,19,27H,7,11H2,1-3H3,(H,29,30)/T19-/M1/S1 | |
| InChI Key | JUZYLCPPVHEVSV-LJQANCHMSA-N | |
| Canonical SMILES | [H][C@@](CO)(C(C)C)N1C=C(C(O)=O)C(=O)C2=C1C=C(OC)C(CC1=C(F)C(Cl)=CC=C1)=C2 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Elvitegravir
| Severity level | ID | Name | Mechanism | Detail |
|---|