Drugs Information: Epoprostenol
Basic Information
|
||
| ID | DDInter657 | |
| Drug Type | small molecule | |
| Molecular Formula | C20H32O5 | |
| Molecular Weight | 352.471 | |
| Description | Epoprostenol is a vasodilator and platelet aggregation inhibitor used for the management of primary pulmonary hypertension and pulmonary hypertension in patients with heart failure. | |
| ATC Classification | B01AC09 | |
| IUPAC Name | 5-[(2Z,3Ar,4R,5R,6As)-5-Hydroxy-4-[(1E,3S)-3-Hydroxyoct-1-En-1-Yl]-Hexahydro-2H-Cyclopenta[B]Furan-2-Ylidene]Pentanoic Acid | |
| InChI | Inchi=1S/C20H32O5/C1-2-3-4-7-14(21)10-11-16-17-12-15(8-5-6-9-20(23)24)25-19(17)13-18(16)22/H8,10-11,14,16-19,21-22H,2-7,9,12-13H2,1H3,(H,23,24)/B11-10+,15-8-/T14-,16+,17+,18+,19-/M0/S1 | |
| InChI Key | KAQKFAOMNZTLHT-OZUDYXHBSA-N | |
| Canonical SMILES | [H][C@]12C[C@@H](O)[C@H](\C=C\[C@@H](O)CCCCC)[C@@]1([H])C\C(O2)=C\CCCC(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Epoprostenol
| Severity level | ID | Name | Mechanism | Detail |
|---|