Drugs Information: Eprosartan
Basic Information
|
||
| ID | DDInter658 | |
| Drug Type | small molecule | |
| Molecular Formula | C23H24N2O4S | |
| Molecular Weight | 424.521 | |
| Description | Eprosartan is an ARB used to treat hypertension, diabetic nephropathy, and congestive heart failure. | |
| ATC Classification | C09DA02 C09CA02 | |
| IUPAC Name | 4-({2-Butyl-5-[(1E)-2-Carboxy-2-(Thiophen-2-Ylmethyl)Eth-1-En-1-Yl]-1H-Imidazol-1-Yl}Methyl)Benzoic Acid | |
| InChI | Inchi=1S/C23H24N2O4S/C1-2-3-6-21-24-14-19(12-18(23(28)29)13-20-5-4-11-30-20)25(21)15-16-7-9-17(10-8-16)22(26)27/H4-5,7-12,14H,2-3,6,13,15H2,1H3,(H,26,27)(H,28,29)/B18-12+ | |
| InChI Key | OROAFUQRIXKEMV-LDADJPATSA-N | |
| Canonical SMILES | CCCCC1=NC=C(\C=C(/CC2=CC=CS2)C(O)=O)N1CC1=CC=C(C=C1)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Eprosartan
| Severity level | ID | Name | Mechanism | Detail |
|---|