Drugs Information: Erlotinib
Basic Information
|
||
| ID | DDInter667 | |
| Drug Type | small molecule | |
| Molecular Formula | C22H23N3O4 | |
| Molecular Weight | 393.443 | |
| Description | Erlotinib is an EGFR tyrosine kinase inhibitor used to treat certain small cell lung cancers or advanced metastatic pancreatic cancers. | |
| ATC Classification | L01XE03 | |
| IUPAC Name | N-(3-Ethynylphenyl)-6,7-Bis(2-Methoxyethoxy)Quinazolin-4-Amine | |
| InChI | Inchi=1S/C22H23N3O4/C1-4-16-6-5-7-17(12-16)25-22-18-13-20(28-10-8-26-2)21(29-11-9-27-3)14-19(18)23-15-24-22/H1,5-7,12-15H,8-11H2,2-3H3,(H,23,24,25) | |
| InChI Key | AAKJLRGGTJKAMG-UHFFFAOYSA-N | |
| Canonical SMILES | COCCOC1=CC2=C(C=C1OCCOC)C(NC1=CC(=CC=C1)C#C)=NC=N2 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Erlotinib
| Severity level | ID | Name | Mechanism | Detail |
|---|