Drugs Information: Aminobenzoic acid
Basic Information
|
|
||
| ID | DDInter69 | |
| Drug Type | small molecule | |
| Molecular Formula | C7H7No2 | |
| Molecular Weight | 137.138 | |
| Description | Aminobenzoic acid is a drug used to reduce the progression of penile deviation in Peyronie's Disease in adults. | |
| ATC Classification | D02BA01 D11AX23 | |
| IUPAC Name | 4-Aminobenzoic Acid | |
| InChI | Inchi=1S/C7H7No2/C8-6-3-1-5(2-4-6)7(9)10/H1-4H,8H2,(H,9,10) | |
| InChI Key | ALYNCZNDIQEVRV-UHFFFAOYSA-N | |
| Canonical SMILES | NC1=CC=C(C=C1)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Aminobenzoic acid
| Severity level | ID | Name | Mechanism | Detail |
|---|