Drugs Information: Aminobenzoic acid
Basic Information
|
||
ID | DDInter69 | |
Drug Type | small molecule | |
Molecular Formula | C7H7No2 | |
Molecular Weight | 137.138 | |
Description | Aminobenzoic acid is a drug used to reduce the progression of penile deviation in Peyronie's Disease in adults. | |
ATC Classification | D02BA01 D11AX23 | |
IUPAC Name | 4-Aminobenzoic Acid | |
InChI | Inchi=1S/C7H7No2/C8-6-3-1-5(2-4-6)7(9)10/H1-4H,8H2,(H,9,10) | |
InChI Key | ALYNCZNDIQEVRV-UHFFFAOYSA-N | |
Canonical SMILES | NC1=CC=C(C=C1)C(O)=O | |
Useful Links | DrugBank ChEMBL PubChem |
Interactions with Aminobenzoic acid
Severity level | ID | Name | Mechanism | Detail |
---|