Drugs Information: Ethionamide
Basic Information
|
||
| ID | DDInter694 | |
| Drug Type | small molecule | |
| Molecular Formula | C8H10N2S | |
| Molecular Weight | 166.248 | |
| Description | Ethionamide is a second line antitubercular agent used to treat tuberculosis when other treatments have failed. | |
| ATC Classification | J04AD03 | |
| IUPAC Name | 2-Ethylpyridine-4-Carbothioamide | |
| InChI | Inchi=1S/C8H10N2S/C1-2-7-5-6(8(9)11)3-4-10-7/H3-5H,2H2,1H3,(H2,9,11) | |
| InChI Key | AEOCXXJPGCBFJA-UHFFFAOYSA-N | |
| Canonical SMILES | CCC1=NC=CC(=C1)C(N)=S | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Ethionamide
| Severity level | ID | Name | Mechanism | Detail |
|---|