Drugs Information: Etidronic acid
Basic Information
|
||
| ID | DDInter698 | |
| Drug Type | small molecule | |
| Molecular Formula | C2H8O7P2 | |
| Molecular Weight | 206.027 | |
| Description | Etidronic acid is a bisphosphonate drug that prevents osteoclastic bone resorption; used for the prevention and treatment of osteoporosis. | |
| ATC Classification | M05BB01 M05BA01 | |
| IUPAC Name | (1-Hydroxy-1-Phosphonoethyl)Phosphonic Acid | |
| InChI | Inchi=1S/C2H8O7P2/C1-2(3,10(4,5)6)11(7,8)9/H3H,1H3,(H2,4,5,6)(H2,7,8,9) | |
| InChI Key | DBVJJBKOTRCVKF-UHFFFAOYSA-N | |
| Canonical SMILES | CC(O)(P(O)(O)=O)P(O)(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Etidronic acid
| Severity level | ID | Name | Mechanism | Detail |
|---|