Drugs Information: Abemaciclib
Basic Information
|
||
| ID | DDInter7 | |
| Drug Type | small molecule | |
| Molecular Formula | C27H32F2N8 | |
| Molecular Weight | 506.605 | |
| Description | Abemaciclib is a medication used to treat HR+ HER2- advanced or metastatic breast cancer. | |
| ATC Classification | L01XE50 | |
| IUPAC Name | N-{5-[(4-Ethylpiperazin-1-Yl)Methyl]Pyridin-2-Yl}-5-Fluoro-4-[4-Fluoro-2-Methyl-1-(Propan-2-Yl)-1H-1,3-Benzodiazol-6-Yl]Pyrimidi | |
| InChI | Inchi=1S/C27H32F2N8/C1-5-35-8-10-36(11-9-35)16-19-6-7-24(30-14-19)33-27-31-15-22(29)25(34-27)20-12-21(28)26-23(13-20)37(17(2)3)18(4)32-26/H6-7,12-15,17H,5,8-11,16H2,1-4H3,(H,30,31,33,34) | |
| InChI Key | UZWDCWONPYILKI-UHFFFAOYSA-N | |
| Canonical SMILES | CCN1CCN(CC2=CC=C(NC3=NC=C(F)C(=N3)C3=CC(F)=C4N=C(C)N(C(C)C)C4=C3)N=C2)CC1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Abemaciclib
| Severity level | ID | Name | Mechanism | Detail |
|---|