Drugs Information: Aminocaproic acid
Basic Information
|
||
| ID | DDInter70 | |
| Drug Type | small molecule | |
| Molecular Formula | C6H13No2 | |
| Molecular Weight | 131.175 | |
| Description | An antifibrinolytic agent that acts by inhibiting plasminogen activators which have fibrinolytic properties. | |
| ATC Classification | B02AA01 | |
| IUPAC Name | 6-Aminohexanoic Acid | |
| InChI | Inchi=1S/C6H13No2/C7-5-3-1-2-4-6(8)9/H1-5,7H2,(H,8,9) | |
| InChI Key | SLXKOJJOQWFEFD-UHFFFAOYSA-N | |
| Canonical SMILES | NCCCCCC(O)=O | |
| Useful Links | DrugBank ChEMBL | |
Interactions with Aminocaproic acid
| Severity level | ID | Name | Mechanism | Detail |
|---|