Drugs Information: Aminoglutethimide
Basic Information
|
||
| ID | DDInter71 | |
| Drug Type | small molecule | |
| Molecular Formula | C13H16N2O2 | |
| Molecular Weight | 232.283 | |
| Description | Aminoglutethimide is an adrenocortical steroid synthesis inhibitor used in the treatment of Cushing's syndrome. | |
| ATC Classification | L02BG01 | |
| IUPAC Name | 3-(4-Aminophenyl)-3-Ethylpiperidine-2,6-Dione | |
| InChI | Inchi=1S/C13H16N2O2/C1-2-13(8-7-11(16)15-12(13)17)9-3-5-10(14)6-4-9/H3-6H,2,7-8,14H2,1H3,(H,15,16,17) | |
| InChI Key | ROBVIMPUHSLWNV-UHFFFAOYSA-N | |
| Canonical SMILES | CCC1(CCC(=O)NC1=O)C1=CC=C(N)C=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Aminoglutethimide
| Severity level | ID | Name | Mechanism | Detail |
|---|