Drugs Information: Famciclovir
Basic Information
|
||
| ID | DDInter711 | |
| Drug Type | small molecule | |
| Molecular Formula | C14H19N5O4 | |
| Molecular Weight | 321.337 | |
| Description | Famciclovir is a nucleoside analog DNA polymerase inhibitor used for the treatment of recurrent cold sores and genital herpes in healthy patients and patients with HIV, and to manage herpes zoster. | |
| ATC Classification | J05AB09 S01AD07 | |
| IUPAC Name | 2-[(Acetyloxy)Methyl]-4-(2-Amino-9H-Purin-9-Yl)Butyl Acetate | |
| InChI | Inchi=1S/C14H19N5O4/C1-9(20)22-6-11(7-23-10(2)21)3-4-19-8-17-12-5-16-14(15)18-13(12)19/H5,8,11H,3-4,6-7H2,1-2H3,(H2,15,16,18) | |
| InChI Key | GGXKWVWZWMLJEH-UHFFFAOYSA-N | |
| Canonical SMILES | CC(=O)OCC(CCN1C=NC2=CN=C(N)N=C12)COC(C)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Famciclovir
| Severity level | ID | Name | Mechanism | Detail |
|---|