Drugs Information: Famotidine
Basic Information
|
||
| ID | DDInter712 | |
| Drug Type | small molecule | |
| Molecular Formula | C8H15N7O2S3 | |
| Molecular Weight | 337.453 | |
| Description | Famotidine is a histamine H2 receptor antagonist used to treat duodenal ulcers, benign gastric ulcers, GERD, and Zollinger-Ellison syndrome. | |
| ATC Classification | A02BA03 A02BA53 | |
| IUPAC Name | 3-[({2-[(Diaminomethylidene)Amino]-1,3-Thiazol-4-Yl}Methyl)Sulfanyl]-N'-Sulfamoylpropanimidamide | |
| InChI | Inchi=1S/C8H15N7O2S3/C9-6(15-20(12,16)17)1-2-18-3-5-4-19-8(13-5)14-7(10)11/H4H,1-3H2,(H2,9,15)(H2,12,16,17)(H4,10,11,13,14) | |
| InChI Key | XUFQPHANEAPEMJ-UHFFFAOYSA-N | |
| Canonical SMILES | NC(N)=NC1=NC(CSCCC(N)=NS(N)(=O)=O)=CS1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Famotidine
| Severity level | ID | Name | Mechanism | Detail |
|---|