Drugs Information: Aminolevulinic acid
Basic Information
|
||
| ID | DDInter72 | |
| Drug Type | small molecule | |
| Molecular Formula | C5H9No3 | |
| Molecular Weight | 131.131 | |
| Description | Aminolevulinic acid is a porphyrin precursor used to treat actinic keratosis of the face, scalp, and upper extremities, as well as to visualize a glioma. | |
| ATC Classification | L01XD04 | |
| IUPAC Name | 5-Amino-4-Oxopentanoic Acid | |
| InChI | Inchi=1S/C5H9No3/C6-3-4(7)1-2-5(8)9/H1-3,6H2,(H,8,9) | |
| InChI Key | ZGXJTSGNIOSYLO-UHFFFAOYSA-N | |
| Canonical SMILES | NCC(=O)CCC(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Aminolevulinic acid
| Severity level | ID | Name | Mechanism | Detail |
|---|