Drugs Information: Fexofenadine
Basic Information
|
||
| ID | DDInter732 | |
| Drug Type | small molecule | |
| Molecular Formula | C32H39No4 | |
| Molecular Weight | 501.667 | |
| Description | Fexofenadine is a selective H1-antagonist for the symptomatic treatment of seasonal allergic rhinitis and chronic idiopathic urticaria. | |
| ATC Classification | R06AX26 | |
| IUPAC Name | 2-(4-{1-Hydroxy-4-[4-(Hydroxydiphenylmethyl)Piperidin-1-Yl]Butyl}Phenyl)-2-Methylpropanoic Acid | |
| InChI | Inchi=1S/C32H39No4/C1-31(2,30(35)36)25-17-15-24(16-18-25)29(34)14-9-21-33-22-19-28(20-23-33)32(37,26-10-5-3-6-11-26)27-12-7-4-8-13-27/H3-8,10-13,15-18,28-29,34,37H,9,14,19-23H2,1-2H3,(H,35,36) | |
| InChI Key | RWTNPBWLLIMQHL-UHFFFAOYSA-N | |
| Canonical SMILES | CC(C)(C(O)=O)C1=CC=C(C=C1)C(O)CCCN1CCC(CC1)C(O)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Fexofenadine
| Severity level | ID | Name | Mechanism | Detail |
|---|