Drugs Information: Finasteride
Basic Information
|
||
| ID | DDInter736 | |
| Drug Type | small molecule | |
| Molecular Formula | C23H36N2O2 | |
| Molecular Weight | 372.553 | |
| Description | Finasteride is an antiandrogenic compound that is used for the treatment of symptomatic benign prostatic hyperplasia (BPH) and male pattern hair loss in adult males by inhibiting Type II 5-alpha reductase. | |
| ATC Classification | D11AX10 G04CA51 G04CB01 | |
| IUPAC Name | (1S,2R,7R,10S,11S,14S,15S)-N-Tert-Butyl-2,15-Dimethyl-5-Oxo-6-Azatetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]Heptadec-3-Ene-14-Carboxamide | |
| InChI | Inchi=1S/C23H36N2O2/C1-21(2,3)25-20(27)17-8-7-15-14-6-9-18-23(5,13-11-19(26)24-18)16(14)10-12-22(15,17)4/H11,13-18H,6-10,12H2,1-5H3,(H,24,26)(H,25,27)/T14-,15-,16-,17+,18+,22-,23+/M0/S1 | |
| InChI Key | DBEPLOCGEIEOCV-WSBQPABSSA-N | |
| Canonical SMILES | [H][C@@]12CC[C@H](C(=O)NC(C)(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])NC(=O)C=C[C@]12C | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Finasteride
| Severity level | ID | Name | Mechanism | Detail |
|---|