Drugs Information: Flecainide
Basic Information
|
||
| ID | DDInter740 | |
| Drug Type | small molecule | |
| Molecular Formula | C17H20F6N2O3 | |
| Molecular Weight | 414.346 | |
| Description | Flecainide is a class Ic antiarrhythmic agent used to manage atrial fibrillation and paroxysmal supraventricular tachycardias (PSVT). | |
| ATC Classification | C01BC04 | |
| IUPAC Name | N-(Piperidin-2-Ylmethyl)-2,5-Bis(2,2,2-Trifluoroethoxy)Benzamide | |
| InChI | Inchi=1S/C17H20F6N2O3/C18-16(19,20)9-27-12-4-5-14(28-10-17(21,22)23)13(7-12)15(26)25-8-11-3-1-2-6-24-11/H4-5,7,11,24H,1-3,6,8-10H2,(H,25,26) | |
| InChI Key | DJBNUMBKLMJRSA-UHFFFAOYSA-N | |
| Canonical SMILES | FC(F)(F)COC1=CC(C(=O)NCC2CCCCN2)=C(OCC(F)(F)F)C=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Flecainide
| Severity level | ID | Name | Mechanism | Detail |
|---|