Drugs Information: Amisulpride
Basic Information
|
|
||
| ID | DDInter77 | |
| Drug Type | small molecule | |
| Molecular Formula | C17H27N3O4S | |
| Molecular Weight | 369.486 | |
| Description | Amisulpride is a dopamine D2 receptor antagonist used in the treatment of acute and chronic schizophrenia, and in the prevention and treatment of postoperative nausea and vomiting in adults. | |
| ATC Classification | N05AL05 | |
| IUPAC Name | 4-Amino-5-(Ethanesulfonyl)-N-[(1-Ethylpyrrolidin-2-Yl)Methyl]-2-Methoxybenzamide | |
| InChI | Inchi=1S/C17H27N3O4S/C1-4-20-8-6-7-12(20)11-19-17(21)13-9-16(25(22,23)5-2)14(18)10-15(13)24-3/H9-10,12H,4-8,11,18H2,1-3H3,(H,19,21) | |
| InChI Key | NTJOBXMMWNYJFB-UHFFFAOYSA-N | |
| Canonical SMILES | CCN1CCCC1CNC(=O)C1=CC(=C(N)C=C1OC)S(=O)(=O)CC | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Amisulpride
| Severity level | ID | Name | Mechanism | Detail |
|---|