Drugs Information: Folic acid
Basic Information
|
||
| ID | DDInter771 | |
| Drug Type | small molecule | |
| Molecular Formula | C19H19N7O6 | |
| Molecular Weight | 441.404 | |
| Description | Folic acid is a nutrient used to treat megaloblastic anemia and is found in many supplements. | |
| ATC Classification | B03AE02 V04CX02 B03BB01 B03AE01 B03BB51 | |
| IUPAC Name | (2S)-2-[(4-{[(2-Amino-4-Oxo-1,4-Dihydropteridin-6-Yl)Methyl]Amino}Phenyl)Formamido]Pentanedioic Acid | |
| InChI | Inchi=1S/C19H19N7O6/C20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/H1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/T12-/M0/S1 | |
| InChI Key | OVBPIULPVIDEAO-LBPRGKRZSA-N | |
| Canonical SMILES | NC1=NC(=O)C2=NC(CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)=CN=C2N1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Folic acid
| Severity level | ID | Name | Mechanism | Detail |
|---|