Drugs Information: Fosamprenavir
Basic Information
|
||
| ID | DDInter777 | |
| Drug Type | small molecule | |
| Molecular Formula | C25H36N3O9Ps | |
| Molecular Weight | 585.615 | |
| Description | Fosamprenavir is an antiretroviral agent used for the treatment and postexposure prophylaxis of human immunodeficiency virus (HIV-1) infection. | |
| ATC Classification | J05AE07 | |
| IUPAC Name | {[(2R,3S)-1-[N-(2-Methylpropyl)4-Aminobenzenesulfonamido]-3-({[(3S)-Oxolan-3-Yloxy]Carbonyl}Amino)-4-Phenylbutan-2-Yl]Oxy}Phosph | |
| InChI | Inchi=1S/C25H36N3O9Ps/C1-18(2)15-28(39(33,34)22-10-8-20(26)9-11-22)16-24(37-38(30,31)32)23(14-19-6-4-3-5-7-19)27-25(29)36-21-12-13-35-17-21/H3-11,18,21,23-24H,12-17,26H2,1-2H3,(H,27,29)(H2,30,31,32)/T21-,23-,24+/M0/S1 | |
| InChI Key | MLBVMOWEQCZNCC-OEMFJLHTSA-N | |
| Canonical SMILES | CC(C)CN(C[C@@H](OP(O)(O)=O)[C@H](CC1=CC=CC=C1)NC(=O)O[C@H]1CCOC1)S(=O)(=O)C1=CC=C(N)C=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Fosamprenavir
| Severity level | ID | Name | Mechanism | Detail |
|---|