Drugs Information: Fosaprepitant
Basic Information
|
||
| ID | DDInter778 | |
| Drug Type | small molecule | |
| Molecular Formula | C23H22F7N4O6P | |
| Molecular Weight | 614.411 | |
| Description | Fosaprepitant is an antiemetic drug used in combination with other antiemetic agents for the prevention of acute and delayed nausea and vomiting caused by chemotherapy. | |
| ATC Classification | - | |
| IUPAC Name | (3-{[(2R,3S)-2-[(1R)-1-[3,5-Bis(Trifluoromethyl)Phenyl]Ethoxy]-3-(4-Fluorophenyl)Morpholin-4-Yl]Methyl}-5-Oxo-2,5-Dihydro-1H-1,2 | |
| InChI | Inchi=1S/C23H22F7N4O6P/C1-12(14-8-15(22(25,26)27)10-16(9-14)23(28,29)30)40-20-19(13-2-4-17(24)5-3-13)33(6-7-39-20)11-18-31-21(35)34(32-18)41(36,37)38/H2-5,8-10,12,19-20H,6-7,11H2,1H3,(H,31,32,35)(H2,36,37,38)/T12-,19+,20-/M1/S1 | |
| InChI Key | BARDROPHSZEBKC-OITMNORJSA-N | |
| Canonical SMILES | C[C@@H](O[C@H]1OCCN(CC2=NC(=O)N(N2)P(O)(O)=O)[C@H]1C1=CC=C(F)C=C1)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Fosaprepitant
| Severity level | ID | Name | Mechanism | Detail |
|---|