Drugs Information: Fosinopril
Basic Information
|
||
| ID | DDInter781 | |
| Drug Type | small molecule | |
| Molecular Formula | C30H46No7P | |
| Molecular Weight | 563.672 | |
| Description | Fosinopril is an ACE inhibitor used to treat mild to moderate hypertension, congestive heart failure, and to slow the progression of renal disease in hypertensive diabetics. | |
| ATC Classification | C09BA09 C09AA09 | |
| IUPAC Name | (2S,4S)-4-Cyclohexyl-1-(2-{[(1S)-2-Methyl-1-(Propanoyloxy)Propoxy](4-Phenylbutyl)Phosphoryl}Acetyl)Pyrrolidine-2-Carboxylic Acid | |
| InChI | Inchi=1S/C30H46No7P/C1-4-28(33)37-30(22(2)3)38-39(36,18-12-11-15-23-13-7-5-8-14-23)21-27(32)31-20-25(19-26(31)29(34)35)24-16-9-6-10-17-24/H5,7-8,13-14,22,24-26,30H,4,6,9-12,15-21H2,1-3H3,(H,34,35)/T25-,26+,30+,39+/M1/S1 | |
| InChI Key | BIDNLKIUORFRQP-FLODCBCLSA-N | |
| Canonical SMILES | CCC(=O)O[C@@H](OP(=O)(CCCCC1=CC=CC=C1)CC(=O)N1C[C@@H](C[C@H]1C(O)=O)C1CCCCC1)C(C)C | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Fosinopril
| Severity level | ID | Name | Mechanism | Detail |
|---|