Drugs Information: Ganciclovir
Basic Information
|
||
| ID | DDInter806 | |
| Drug Type | small molecule | |
| Molecular Formula | C9H13N5O4 | |
| Molecular Weight | 255.234 | |
| Description | Ganciclovir is a DNA polymerase inhibitor used to treat cytomegalovirus and herpetic keratitis of the eye. | |
| ATC Classification | J05AB06 S01AD09 | |
| IUPAC Name | 2-Amino-9-{[(1,3-Dihydroxypropan-2-Yl)Oxy]Methyl}-6,9-Dihydro-1H-Purin-6-One | |
| InChI | Inchi=1S/C9H13N5O4/C10-9-12-7-6(8(17)13-9)11-3-14(7)4-18-5(1-15)2-16/H3,5,15-16H,1-2,4H2,(H3,10,12,13,17) | |
| InChI Key | IRSCQMHQWWYFCW-UHFFFAOYSA-N | |
| Canonical SMILES | NC1=NC2=C(N=CN2COC(CO)CO)C(=O)N1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Ganciclovir
| Severity level | ID | Name | Mechanism | Detail |
|---|