Drugs Information: Gatifloxacin
Basic Information
|
||
| ID | DDInter809 | |
| Drug Type | small molecule | |
| Molecular Formula | C19H22Fn3O4 | |
| Molecular Weight | 375.400 | |
| Description | Gatifloxacin is a fourth generation fluoroquinolone used to treat a wide variety of infections in the body. | |
| ATC Classification | S01AE06 J01MA16 | |
| IUPAC Name | 1-Cyclopropyl-6-Fluoro-8-Methoxy-7-(3-Methylpiperazin-1-Yl)-4-Oxo-1,4-Dihydroquinoline-3-Carboxylic Acid | |
| InChI | Inchi=1S/C19H22Fn3O4/C1-10-8-22(6-5-21-10)16-14(20)7-12-15(18(16)27-2)23(11-3-4-11)9-13(17(12)24)19(25)26/H7,9-11,21H,3-6,8H2,1-2H3,(H,25,26) | |
| InChI Key | XUBOMFCQGDBHNK-UHFFFAOYSA-N | |
| Canonical SMILES | COC1=C2N(C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCNC(C)C1)C1CC1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Gatifloxacin
| Severity level | ID | Name | Mechanism | Detail |
|---|