Drugs Information: Gefitinib
Basic Information
|
||
| ID | DDInter810 | |
| Drug Type | small molecule | |
| Molecular Formula | C22H24Clfn4O3 | |
| Molecular Weight | 446.910 | |
| Description | Gefitinib is a tyrosine kinase inhibitor used as first-line therapy to treat non-small cell lung carcinoma (NSCLC) that meets certain genetic mutation criteria. | |
| ATC Classification | L01XE02 | |
| IUPAC Name | N-(3-Chloro-4-Fluorophenyl)-7-Methoxy-6-[3-(Morpholin-4-Yl)Propoxy]Quinazolin-4-Amine | |
| InChI | Inchi=1S/C22H24Clfn4O3/C1-29-20-13-19-16(12-21(20)31-8-2-5-28-6-9-30-10-7-28)22(26-14-25-19)27-15-3-4-18(24)17(23)11-15/H3-4,11-14H,2,5-10H2,1H3,(H,25,26,27) | |
| InChI Key | XGALLCVXEZPNRQ-UHFFFAOYSA-N | |
| Canonical SMILES | COC1=C(OCCCN2CCOCC2)C=C2C(NC3=CC(Cl)=C(F)C=C3)=NC=NC2=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Gefitinib
| Severity level | ID | Name | Mechanism | Detail |
|---|