Drugs Information: Glimepiride
Basic Information
|
||
| ID | DDInter825 | |
| Drug Type | small molecule | |
| Molecular Formula | C24H34N4O5S | |
| Molecular Weight | 490.625 | |
| Description | Glimepiride is a sulfonylurea drug used to treat type 2 diabetes mellitus. | |
| ATC Classification | A10BD04 A10BB12 A10BD06 | |
| IUPAC Name | 3-Ethyl-4-Methyl-2-Oxo-N-(2-{4-[({[(1R,4R)-4-Methylcyclohexyl]Carbamoyl}Amino)Sulfonyl]Phenyl}Ethyl)-2,5-Dihydro-1H-Pyrrole-1-Ca | |
| InChI | Inchi=1S/C24H34N4O5S/C1-4-21-17(3)15-28(22(21)29)24(31)25-14-13-18-7-11-20(12-8-18)34(32,33)27-23(30)26-19-9-5-16(2)6-10-19/H7-8,11-12,16,19H,4-6,9-10,13-15H2,1-3H3,(H,25,31)(H2,26,27,30)/T16-,19- | |
| InChI Key | WIGIZIANZCJQQY-RUCARUNLSA-N | |
| Canonical SMILES | CCC1=C(C)CN(C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)NC(=O)N[C@H]2CC[C@H](C)CC2)C1=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Glimepiride
| Severity level | ID | Name | Mechanism | Detail |
|---|