Drugs Information: Glipizide
Basic Information
|
|
||
| ID | DDInter826 | |
| Drug Type | small molecule | |
| Molecular Formula | C21H27N5O4S | |
| Molecular Weight | 445.544 | |
| Description | Glipizide is a sulfonylurea medication used in Type 2 Diabetes to sensitize pancreatic beta cells and stimulate insulin release. | |
| ATC Classification | A10BB07 | |
| IUPAC Name | N-[2-(4-{[(Cyclohexylcarbamoyl)Amino]Sulfonyl}Phenyl)Ethyl]-5-Methylpyrazine-2-Carboxamide | |
| InChI | Inchi=1S/C21H27N5O4S/C1-15-13-24-19(14-23-15)20(27)22-12-11-16-7-9-18(10-8-16)31(29,30)26-21(28)25-17-5-3-2-4-6-17/H7-10,13-14,17H,2-6,11-12H2,1H3,(H,22,27)(H2,25,26,28) | |
| InChI Key | ZJJXGWJIGJFDTL-UHFFFAOYSA-N | |
| Canonical SMILES | CC1=NC=C(N=C1)C(=O)NCCC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCC1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Glipizide
| Severity level | ID | Name | Mechanism | Detail |
|---|