Drugs Information: Glyburide
Basic Information
|
|
||
| ID | DDInter831 | |
| Drug Type | small molecule | |
| Molecular Formula | C23H28Cln3O5S | |
| Molecular Weight | 494.012 | |
| Description | Glyburide is a sulfonylurea used in the treatment of non insulin dependent diabetes mellitus. | |
| ATC Classification | A10BB01 | |
| IUPAC Name | 5-Chloro-N-[2-(4-{[(Cyclohexylcarbamoyl)Amino]Sulfonyl}Phenyl)Ethyl]-2-Methoxybenzamide | |
| InChI | Inchi=1S/C23H28Cln3O5S/C1-32-21-12-9-17(24)15-20(21)22(28)25-14-13-16-7-10-19(11-8-16)33(30,31)27-23(29)26-18-5-3-2-4-6-18/H7-12,15,18H,2-6,13-14H2,1H3,(H,25,28)(H2,26,27,29) | |
| InChI Key | ZNNLBTZKUZBEKO-UHFFFAOYSA-N | |
| Canonical SMILES | COC1=C(C=C(Cl)C=C1)C(=O)NCCC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCC1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Glyburide
| Severity level | ID | Name | Mechanism | Detail |
|---|