Drugs Information: Amphetamine
Basic Information
|
||
| ID | DDInter84 | |
| Drug Type | small molecule | |
| Molecular Formula | C9H13N | |
| Molecular Weight | 135.210 | |
| Description | Amphetamine is a CNS stimulant and sympathomimetic agent indicated for the treatment of Attention Deficit Hyperactivity Disorder (ADHD). | |
| ATC Classification | N06BA01 | |
| IUPAC Name | 1-Phenylpropan-2-Amine | |
| InChI | Inchi=1S/C9H13N/C1-8(10)7-9-5-3-2-4-6-9/H2-6,8H,7,10H2,1H3 | |
| InChI Key | KWTSXDURSIMDCE-UHFFFAOYSA-N | |
| Canonical SMILES | CC(N)CC1=CC=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Amphetamine
| Severity level | ID | Name | Mechanism | Detail |
|---|