Drugs Information: Granisetron
Basic Information
|
||
| ID | DDInter840 | |
| Drug Type | small molecule | |
| Molecular Formula | C18H24N4O | |
| Molecular Weight | 312.417 | |
| Description | Granisetron is a 5HT3 antagonist used to treat nausea and vomiting in cancer therapy and postoperatively. | |
| ATC Classification | A04AA02 | |
| IUPAC Name | 1-Methyl-N-[(1R,3R,5S)-9-Methyl-9-Azabicyclo[3.3.1]Nonan-3-Yl]-1H-Indazole-3-Carboxamide | |
| InChI | Inchi=1S/C18H24N4O/C1-21-13-6-5-7-14(21)11-12(10-13)19-18(23)17-15-8-3-4-9-16(15)22(2)20-17/H3-4,8-9,12-14H,5-7,10-11H2,1-2H3,(H,19,23)/T12-,13+,14- | |
| InChI Key | MFWNKCLOYSRHCJ-BTTYYORXSA-N | |
| Canonical SMILES | CN1N=C(C(=O)N[C@@H]2C[C@@H]3CCC[C@H](C2)N3C)C2=C1C=CC=C2 | |
| Useful Links | DrugBank PubChem | |
Interactions with Granisetron
| Severity level | ID | Name | Mechanism | Detail |
|---|