Drugs Information: Hyaluronic acid
Basic Information
|
|
||
| ID | DDInter880 | |
| Drug Type | small molecule | |
| Molecular Formula | C28H44N2O23 | |
| Molecular Weight | 776.651 | |
| Description | Hyaluronic acid is a glycosaminoglycan used for the relief of joint pain, wound healing, ophthalmologic treatment, cosmetic treatment, and various other applications. | |
| ATC Classification | S01KA51 S01KA01 D03AX05 M09AX01 R01AX09 | |
| IUPAC Name | (2S,3S,4R,5R,6R)-3-{[(2S,3R,5S,6R)-4-{[(2R,3R,4S,5S,6S)-6-Carboxy-3,4,5-Trihydroxyoxan-2-Yl]Oxy}-3-Acetamido-5-Hydroxy-6-(Hydrox | |
| InChI | Inchi=1S/C28H44N2O23/C1-5(33)29-9-18(11(35)7(3-31)47-25(9)46)49-28-17(41)15(39)20(22(53-28)24(44)45)51-26-10(30-6(2)34)19(12(36)8(4-32)48-26)50-27-16(40)13(37)14(38)21(52-27)23(42)43/H7-22,25-28,31-32,35-41,46H,3-4H2,1-2H3,(H,29,33)(H,30,34)(H,42,43)(H,44,45)/T7-,8-,9-,10-,11-,12-,13+,14+,15-,16-,17-,18?,19?,20+,21+,22+,25-,26+,27-,28-/M1/S1 | |
| InChI Key | KIUKXJAPPMFGSW-MNSSHETKSA-N | |
| Canonical SMILES | CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)C1O[C@@H]1O[C@@H]([C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)C(O[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)C(O)=O)[C@H]2NC(C)=O)[C@H](O)[C@H]1O)C(O)=O | |
| Useful Links | DrugBank PubChem | |
Interactions with Hyaluronic acid
| Severity level | ID | Name | Mechanism | Detail |
|---|