Drugs Information: Acalabrutinib
Basic Information
|
|
||
| ID | DDInter9 | |
| Drug Type | small molecule | |
| Molecular Formula | C26H23N7O2 | |
| Molecular Weight | 465.517 | |
| Description | Acalabrutinib is a Bruton tyrosine kinase inhibitor used to treat mantle cell lymphoma, chronic lymphocytic leukemia, and small lymphocytic lymphoma. | |
| ATC Classification | L01XE51 | |
| IUPAC Name | 4-{8-Amino-3-[(2S)-1-(But-2-Ynoyl)Pyrrolidin-2-Yl]Imidazo[1,5-A]Pyrazin-1-Yl}-N-(Pyridin-2-Yl)Benzamide | |
| InChI | Inchi=1S/C26H23N7O2/C1-2-6-21(34)32-15-5-7-19(32)25-31-22(23-24(27)29-14-16-33(23)25)17-9-11-18(12-10-17)26(35)30-20-8-3-4-13-28-20/H3-4,8-14,16,19H,5,7,15H2,1H3,(H2,27,29)(H,28,30,35)/T19-/M0/S1 | |
| InChI Key | WDENQIQQYWYTPO-IBGZPJMESA-N | |
| Canonical SMILES | CC#CC(=O)N1CCC[C@H]1C1=NC(=C2N1C=CN=C2N)C1=CC=C(C=C1)C(=O)NC1=CC=CC=N1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Acalabrutinib
| Severity level | ID | Name | Mechanism | Detail |
|---|