Drugs Information: Indapamide
Basic Information
|
||
| ID | DDInter916 | |
| Drug Type | small molecule | |
| Molecular Formula | C16H16Cln3O3S | |
| Molecular Weight | 365.841 | |
| Description | Indapamide is a thiazide diuretic used to treat hypertension as well as edema due to congestive heart failure. | |
| ATC Classification | C03BA11 C09BX01 G01AE10 C10BX13 | |
| IUPAC Name | 4-Chloro-N-(2-Methyl-2,3-Dihydro-1H-Indol-1-Yl)-3-Sulfamoylbenzamide | |
| InChI | Inchi=1S/C16H16Cln3O3S/C1-10-8-11-4-2-3-5-14(11)20(10)19-16(21)12-6-7-13(17)15(9-12)24(18,22)23/H2-7,9-10H,8H2,1H3,(H,19,21)(H2,18,22,23) | |
| InChI Key | NDDAHWYSQHTHNT-UHFFFAOYSA-N | |
| Canonical SMILES | CC1CC2=CC=CC=C2N1NC(=O)C1=CC(=C(Cl)C=C1)S(N)(=O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Indapamide
| Severity level | ID | Name | Mechanism | Detail |
|---|