Drugs Information: Iobenguane (I-131)
Basic Information
|
|
||
| ID | DDInter952 | |
| Drug Type | small molecule | |
| Molecular Formula | C8H10In3 | |
| Molecular Weight | 275.093 | |
| Description | Iobenguane is a radiopharmaceutical agent used for the diagnosis of primary and metastatic pheochromocytoma or neuroblastoma. | |
| ATC Classification | V09IX01 V09IX02 V10XA02 | |
| IUPAC Name | 2-[(3-Iodophenyl)Methyl]Guanidine | |
| InChI | Inchi=1S/C8H10In3/C9-7-3-1-2-6(4-7)5-12-8(10)11/H1-4H,5H2,(H4,10,11,12) | |
| InChI Key | PDWUPXJEEYOOTR-UHFFFAOYSA-N | |
| Canonical SMILES | NC(N)=NCC1=CC(I)=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Iobenguane (I-131)
| Severity level | ID | Name | Mechanism | Detail |
|---|