Drugs Information: Isometheptene
Basic Information
|
||
| ID | DDInter985 | |
| Drug Type | small molecule | |
| Molecular Formula | C9H19N | |
| Molecular Weight | 141.258 | |
| Description | Isometheptene is a sympathomimetic used to relieve painful spasms in combination with other agents such as caffeine and metamizole. | |
| ATC Classification | A03AX10 | |
| IUPAC Name | Methyl(6-Methylhept-5-En-2-Yl)Amine | |
| InChI | Inchi=1S/C9H19N/C1-8(2)6-5-7-9(3)10-4/H6,9-10H,5,7H2,1-4H3 | |
| InChI Key | XVQUOJBERHHONY-UHFFFAOYSA-N | |
| Canonical SMILES | CNC(C)CCC=C(C)C | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Isometheptene
| Severity level | ID | Name | Mechanism | Detail |
|---|